1-hydroxy-4-unsubstituted benzenoids
Medchemexpress LLC 1-Indanone (α-Hydrindone) | 83-33-0 | 132.16 | 1000 G
1-Indanone is a biochemical reagent that can be used as a biological material or organic compound for life science related research. It is also an oxidation product and a component of fuels, solvents, and varnishes. It plays a role in steroid hormone biosynthesis and arachidonic acid metabolism pathways.
- Biochemical reagent for life science research
- Component of fuels, solvents, and varnishes
- Involved in steroid hormone biosynthesis pathways
- Involved in arachidonic acid metabolism pathways
eMolecules 18980-21-7 | Ambeed | 4-Bromo-2-ethylphenol | 100mg | 601095869 | A408223 | MFCD00055489 | 201.063 | C8H9BrO
Pharmablock | 2-(4-bromo-2-pyridyl)acetonitrile | 25mg | 788568565 | PBU6306 | 312325-73-8 | MFCD09999985 | 197.035 | C7H5BrN2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Aobchem 2-Fluro-6-isopropoxyphenol | ≥97% | CAS 1055315-24-6 | C9H11FO2 | 500mg
2-Fluro-6-isopropoxyphenol | ≥97% | CAS 1055315-24-6 | C9H11FO2 | 500mg
eMolecules DL-phenylephrine hydrochloride | 154-86-9 | MFCD00070603 | 1g
Combi-Blocks, Inc. | DL-phenylephrine hydrochloride | 1g | 603145209 | QC-6510 | 95.000 | 154-86-9 | MFCD00070603 | 203.670 | C9H14ClNO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Aobchem 3-(Trifluoromethoxy)phenol, AOBCHEM USA 14472-25G. 827-99-6. MFCD00040987
3-(Trifluoromethoxy)phenol, AOBCHEM USA 14472-25G. 827-99-6. MFCD00040987
eMolecules 1300582-07-3 | 1-(5-Fluoro-2-hydroxyphenyl)-2-(3-fluorophenyl)ethanone | Synthonix - Stock | MFCD29924229 | 248.229 | C14H10F2O2 | 95.000 | Oc1ccc(F)cc1C(=O)Cc1cccc(F)c1 | 1g | 495868701
1-(5-Fluoro-2-hydroxyphenyl)-2-(3-fluorophenyl)ethanone | Synthonix - Stock | 1300582-07-3 | MFCD29924229 | 248.229 | C14H10F2O2 | 95.000 | Oc1ccc(F)cc1C(=O)Cc1cccc(F)c1 | 1g | 495868701
![eMolecules 5470-17-7 | 3-Bromo-2-chloro-5-nitropyridine | Ambeed | MFCD00233989 | 237.440 | C5H2BrClN2O2 | 98.000 | [O-][N+](=O)c1cnc(Cl)c(Br)c1 | 100g | 572824329](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000470363.jpg-250.jpg)
eMolecules 5470-17-7 | 3-Bromo-2-chloro-5-nitropyridine | Ambeed | MFCD00233989 | 237.440 | C5H2BrClN2O2 | 98.000 | [O-][N+](=O)c1cnc(Cl)c(Br)c1 | 100g | 572824329
3-Bromo-2-chloro-5-nitropyridine | Ambeed | 5470-17-7 | MFCD00233989 | 237.440 | C5H2BrClN2O2 | 98.000 | [O-][N+](=O)c1cnc(Cl)c(Br)c1 | 100g | 572824329
![eMolecules 5470-17-7 | 3-Bromo-2-chloro-5-nitropyridine | Chem-Impex | MFCD00233989 | 237.440 | C5H2BrClN2O2 | 99.000 | [O-][N+](=O)c1cnc(Cl)c(Br)c1 | 250g | 386901753](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000491831.jpg-250.jpg)
eMolecules 5470-17-7 | 3-Bromo-2-chloro-5-nitropyridine | Chem-Impex | MFCD00233989 | 237.440 | C5H2BrClN2O2 | 99.000 | [O-][N+](=O)c1cnc(Cl)c(Br)c1 | 250g | 386901753
3-Bromo-2-chloro-5-nitropyridine | Chem-Impex | 5470-17-7 | MFCD00233989 | 237.440 | C5H2BrClN2O2 | 99.000 | [O-][N+](=O)c1cnc(Cl)c(Br)c1 | 250g | 386901753
![eMolecules 400744-34-5 | 3-[4-(Benzyloxy)phenyl]aniline | Combi-Blocks | MFCD04039050 | 275.351 | C19H17NO | 96.000 | Nc1cccc(c1)-c1ccc(OCc2ccccc2)cc1 | 1g | 205384988](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502185323.JPG-250.jpg)
eMolecules 400744-34-5 | 3-[4-(Benzyloxy)phenyl]aniline | Combi-Blocks | MFCD04039050 | 275.351 | C19H17NO | 96.000 | Nc1cccc(c1)-c1ccc(OCc2ccccc2)cc1 | 1g | 205384988
3-[4-(Benzyloxy)phenyl]aniline | Combi-Blocks | 400744-34-5 | MFCD04039050 | 275.351 | C19H17NO | 96.000 | Nc1cccc(c1)-c1ccc(OCc2ccccc2)cc1 | 1g | 205384988
Aobchem 4-Bromo-5-methyl-2-nitrophenol | ≥97% | CAS 182500-28-3 | C7H6BrNO3 | 250mg
4-Bromo-5-methyl-2-nitrophenol | ≥97% | CAS 182500-28-3 | C7H6BrNO3 | 250mg
Aobchem 4-Fluoro-2-isopropoxyphenol | ≥95% | CAS 1243454-07-0 | C9H11FO2 | 500mg
4-Fluoro-2-isopropoxyphenol | ≥95% | CAS 1243454-07-0 | C9H11FO2 | 500mg
Selleck Chemical LLC 4-Ethylphenol
4-Ethylphenol (P-Ethylphenol 4-Hydroxyphenylethane) is a phenolic compound produced in wine and beer by the spoilage yeast Brettanomyces
Medchemexpress LLC Guaiacol carbonate | 553-17-3 | MFCD00025723 | 500mg
Guaiacol Carbonate acts as an expectorant by virtue of a reflex from the stomach by way of the afferent gastric nerves to the medullary centres and thenperipherally again to the respiratory tract[1]